C21H25N3O3 — CID 56911764
1-[2-[(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-2-oxoethyl]pyrimidin-2-one (PubChem CID 56911764) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 1-[2-[(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-2-oxoethyl]pyrimidin-2-one.
| Compound Name | 1-[2-[(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-2-oxoethyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 56911764 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 1-[2-[(4S,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-2-oxoethyl]pyrimidin-2-one |
| SMILES | O=C(Cn1cccnc1=O)N1CC[C@@](O)(c2ccccc2)[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C21H25N3O3/c25-19(15-23-13-6-12-22-20(23)26)24-14-11-21(27,16-7-2-1-3-8-16)17-9-4-5-10-18(17)24/h1-3,6-8,12-13,17-18,27H,4-5,9-11,14-15H2/t17-,18-,21+/m0/s1 |
| InChIKey | OTFQIZVBIVGQEI-BBTUJRGHSA-N |
| XLogP | 1.92 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |