C18H23N3O2 — CID 95270190
(2S)-2-(1,3-dioxolan-2-yl)-1-[(4-pyrazol-1-ylphenyl)methyl]piperidine (PubChem CID 95270190) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxolan-2-yl)-1-[(4-pyrazol-1-ylphenyl)methyl]piperidine.
| Compound Name | (2S)-2-(1,3-dioxolan-2-yl)-1-[(4-pyrazol-1-ylphenyl)methyl]piperidine |
|---|---|
| PubChem CID | 95270190 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | (2S)-2-(1,3-dioxolan-2-yl)-1-[(4-pyrazol-1-ylphenyl)methyl]piperidine |
| SMILES | c1cnn(-c2ccc(CN3CCCC[C@H]3C3OCCO3)cc2)c1 |
| InChI | InChI=1S/C18H23N3O2/c1-2-10-20(17(4-1)18-22-12-13-23-18)14-15-5-7-16(8-6-15)21-11-3-9-19-21/h3,5-9,11,17-18H,1-2,4,10,12-14H2/t17-/m0/s1 |
| InChIKey | VYIRZTRVTLKHTQ-KRWDZBQOSA-N |
| XLogP | 2.60 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |