C17H24N4 — CID 63250287
N-methyl-1-[1-[(4-pyrazol-1-ylphenyl)methyl]piperidin-2-yl]methanamine (PubChem CID 63250287) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is N-methyl-1-[1-[(4-pyrazol-1-ylphenyl)methyl]piperidin-2-yl]methanamine.
| Compound Name | N-methyl-1-[1-[(4-pyrazol-1-ylphenyl)methyl]piperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 63250287 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | N-methyl-1-[1-[(4-pyrazol-1-ylphenyl)methyl]piperidin-2-yl]methanamine |
| SMILES | CNCC1CCCCN1Cc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C17H24N4/c1-18-13-17-5-2-3-11-20(17)14-15-6-8-16(9-7-15)21-12-4-10-19-21/h4,6-10,12,17-18H,2-3,5,11,13-14H2,1H3 |
| InChIKey | LGIMQCSWEKBNFX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |