C13H24N4 — CID 62126735
1-[1-[(1-ethylpyrazol-4-yl)methyl]piperidin-2-yl]-N-methylmethanamine (PubChem CID 62126735) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-[1-[(1-ethylpyrazol-4-yl)methyl]piperidin-2-yl]-N-methylmethanamine.
| Compound Name | 1-[1-[(1-ethylpyrazol-4-yl)methyl]piperidin-2-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 62126735 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 1-[1-[(1-ethylpyrazol-4-yl)methyl]piperidin-2-yl]-N-methylmethanamine |
| SMILES | CCn1cc(CN2CCCCC2CNC)cn1 |
| InChI | InChI=1S/C13H24N4/c1-3-17-11-12(8-15-17)10-16-7-5-4-6-13(16)9-14-2/h8,11,13-14H,3-7,9-10H2,1-2H3 |
| InChIKey | UIJALCNXQGLPMQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |