C16H19N3O2 — CID 62027872
methyl 1-[(4-pyrazol-1-ylphenyl)methyl]pyrrolidine-2-carboxylate (PubChem CID 62027872) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is methyl 1-[(4-pyrazol-1-ylphenyl)methyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[(4-pyrazol-1-ylphenyl)methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 62027872 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | methyl 1-[(4-pyrazol-1-ylphenyl)methyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1Cc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C16H19N3O2/c1-21-16(20)15-4-2-10-18(15)12-13-5-7-14(8-6-13)19-11-3-9-17-19/h3,5-9,11,15H,2,4,10,12H2,1H3 |
| InChIKey | COOXPWKESMRNHV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |