C18H24N2O3 — CID 95079416
2-ethoxy-6-[[(2R)-2-(3-ethyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]methyl]phenol (PubChem CID 95079416) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-ethoxy-6-[[(2R)-2-(3-ethyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]methyl]phenol.
| Compound Name | 2-ethoxy-6-[[(2R)-2-(3-ethyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 95079416 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 2-ethoxy-6-[[(2R)-2-(3-ethyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]methyl]phenol |
| SMILES | CCOc1cccc(CN2CCC[C@@H]2c2cc(CC)no2)c1O |
| InChI | InChI=1S/C18H24N2O3/c1-3-14-11-17(23-19-14)15-8-6-10-20(15)12-13-7-5-9-16(18(13)21)22-4-2/h5,7,9,11,15,21H,3-4,6,8,10,12H2,1-2H3/t15-/m1/s1 |
| InChIKey | JPIOEJBRLHKAQP-OAHLLOKOSA-N |
| XLogP | 3.68 |
| TPSA | 58.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|