C18H22ClN3OS — CID 100882434
3-[[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-5-(2-chlorophenyl)-1,3,4-oxadiazole-2-thione (PubChem CID 100882434) has the molecular formula C18H22ClN3OS and a molecular weight of 363.91 g/mol. Its IUPAC name is 3-[[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-5-(2-chlorophenyl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-5-(2-chlorophenyl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 100882434 |
| Molecular Formula | C18H22ClN3OS |
| Molecular Weight | 363.91 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 3-[[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-5-(2-chlorophenyl)-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1oc(-c2ccccc2Cl)nn1CN1CCC[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C18H22ClN3OS/c19-15-9-3-2-8-14(15)17-20-22(18(24)23-17)12-21-11-5-7-13-6-1-4-10-16(13)21/h2-3,8-9,13,16H,1,4-7,10-12H2/t13-,16+/m0/s1 |
| InChIKey | JVLNHMIJCWXZMX-XJKSGUPXSA-N |
| XLogP | 5.14 |
| TPSA | 34.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.91 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|