C18H24N4S — CID 11925101
2-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-phenyl-1,2,4-triazole-3-thione (PubChem CID 11925101) has the molecular formula C18H24N4S and a molecular weight of 328.48 g/mol. Its IUPAC name is 2-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 11925101 |
| Molecular Formula | C18H24N4S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-phenyl-1,2,4-triazole-3-thione |
| SMILES | S=c1n(-c2ccccc2)cnn1CN1CCC[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C18H24N4S/c23-18-21(16-9-2-1-3-10-16)13-19-22(18)14-20-12-6-8-15-7-4-5-11-17(15)20/h1-3,9-10,13,15,17H,4-8,11-12,14H2/t15-,17+/m1/s1 |
| InChIKey | SGJNEGGBIOTPRK-WBVHZDCISA-N |
| XLogP | 4.02 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|