C26H30N4O2S — CID 100882879
2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-(1,3-benzodioxol-5-ylmethyl)-5-phenyl-1,2,4-triazole-3-thione (PubChem CID 100882879) has the molecular formula C26H30N4O2S and a molecular weight of 462.62 g/mol. Its IUPAC name is 2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-(1,3-benzodioxol-5-ylmethyl)-5-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-(1,3-benzodioxol-5-ylmethyl)-5-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 100882879 |
| Molecular Formula | C26H30N4O2S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-(1,3-benzodioxol-5-ylmethyl)-5-phenyl-1,2,4-triazole-3-thione |
| SMILES | S=c1n(CN2CCC[C@H]3CCCC[C@H]32)nc(-c2ccccc2)n1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H30N4O2S/c33-26-29(16-19-12-13-23-24(15-19)32-18-31-23)25(21-8-2-1-3-9-21)27-30(26)17-28-14-6-10-20-7-4-5-11-22(20)28/h1-3,8-9,12-13,15,20,22H,4-7,10-11,14,16-18H2/t20-,22-/m1/s1 |
| InChIKey | SZCSMJCCQBHWHP-IFMALSPDSA-N |
| XLogP | 5.47 |
| TPSA | 44.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|