C17H23NO3 — CID 73142374
6-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-1,3-benzodioxol-5-ol (PubChem CID 73142374) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is 6-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-1,3-benzodioxol-5-ol.
| Compound Name | 6-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 73142374 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 6-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-1,3-benzodioxol-5-ol |
| SMILES | Oc1cc2c(cc1CN1CCCC3CCCCC31)OCO2 |
| InChI | InChI=1S/C17H23NO3/c19-15-9-17-16(20-11-21-17)8-13(15)10-18-7-3-5-12-4-1-2-6-14(12)18/h8-9,12,14,19H,1-7,10-11H2 |
| InChIKey | WMZFNEJSAPQZMB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|