C17H21FN2 — CID 102726395
3-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-fluorobenzonitrile (PubChem CID 102726395) has the molecular formula C17H21FN2 and a molecular weight of 272.37 g/mol. Its IUPAC name is 3-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-fluorobenzonitrile.
| Compound Name | 3-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 102726395 |
| Molecular Formula | C17H21FN2 |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 3-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)c(CN2CCC[C@H]3CCCC[C@H]32)c1 |
| InChI | InChI=1S/C17H21FN2/c18-16-8-7-13(11-19)10-15(16)12-20-9-3-5-14-4-1-2-6-17(14)20/h7-8,10,14,17H,1-6,9,12H2/t14-,17-/m1/s1 |
| InChIKey | XDAFLBJQNXQJCS-RHSMWYFYSA-N |
| XLogP | 3.85 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |