C15H19FN2 — CID 55040035
3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzonitrile (PubChem CID 55040035) has the molecular formula C15H19FN2 and a molecular weight of 246.33 g/mol. Its IUPAC name is 3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzonitrile.
| Compound Name | 3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 55040035 |
| Molecular Formula | C15H19FN2 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzonitrile |
| SMILES | CC1CCCN(Cc2cc(C#N)ccc2F)C1C |
| InChI | InChI=1S/C15H19FN2/c1-11-4-3-7-18(12(11)2)10-14-8-13(9-17)5-6-15(14)16/h5-6,8,11-12H,3-4,7,10H2,1-2H3 |
| InChIKey | LNWRSGKRXDGYLU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |