C13H15FN2O — CID 36800430
4-fluoro-3-[[(3S)-3-hydroxypiperidin-1-yl]methyl]benzonitrile (PubChem CID 36800430) has the molecular formula C13H15FN2O and a molecular weight of 234.27 g/mol. Its IUPAC name is 4-fluoro-3-[[(3S)-3-hydroxypiperidin-1-yl]methyl]benzonitrile.
| Compound Name | 4-fluoro-3-[[(3S)-3-hydroxypiperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 36800430 |
| Molecular Formula | C13H15FN2O |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 4-fluoro-3-[[(3S)-3-hydroxypiperidin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(F)c(CN2CCC[C@H](O)C2)c1 |
| InChI | InChI=1S/C13H15FN2O/c14-13-4-3-10(7-15)6-11(13)8-16-5-1-2-12(17)9-16/h3-4,6,12,17H,1-2,5,8-9H2/t12-/m0/s1 |
| InChIKey | OCTSDSPHMDNBKT-LBPRGKRZSA-N |
| XLogP | 1.65 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |