C20H21FN2O — CID 86972233
4-fluoro-3-[[3-(phenoxymethyl)piperidin-1-yl]methyl]benzonitrile (PubChem CID 86972233) has the molecular formula C20H21FN2O and a molecular weight of 324.40 g/mol. Its IUPAC name is 4-fluoro-3-[[3-(phenoxymethyl)piperidin-1-yl]methyl]benzonitrile.
| Compound Name | 4-fluoro-3-[[3-(phenoxymethyl)piperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 86972233 |
| Molecular Formula | C20H21FN2O |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-fluoro-3-[[3-(phenoxymethyl)piperidin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(F)c(CN2CCCC(COc3ccccc3)C2)c1 |
| InChI | InChI=1S/C20H21FN2O/c21-20-9-8-16(12-22)11-18(20)14-23-10-4-5-17(13-23)15-24-19-6-2-1-3-7-19/h1-3,6-9,11,17H,4-5,10,13-15H2 |
| InChIKey | SKFVDBUAAIVNCM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |