C23H33N3O3 — CID 17413435
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 17413435) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 17413435 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(Cc2ccc3c(c2)OCO3)CC1)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C23H33N3O3/c27-23(26-9-3-5-19-4-1-2-6-20(19)26)16-25-12-10-24(11-13-25)15-18-7-8-21-22(14-18)29-17-28-21/h7-8,14,19-20H,1-6,9-13,15-17H2 |
| InChIKey | YJKVTAQZLORGBO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |