C24H35N3O2 — CID 30638446
1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 30638446) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is 1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 30638446 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(Cc2ccc3c(c2)CCO3)CC1)N1CCC[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C24H35N3O2/c28-24(27-10-3-5-20-4-1-2-6-22(20)27)18-26-13-11-25(12-14-26)17-19-7-8-23-21(16-19)9-15-29-23/h7-8,16,20,22H,1-6,9-15,17-18H2/t20-,22+/m1/s1 |
| InChIKey | PEVHDGBCKAYQGX-IRLDBZIGSA-N |
| XLogP | 2.92 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |