C23H27N5O2S — CID 2425905
5-(1,3-benzodioxol-5-yl)-2-[[methyl-(1-methylpiperidin-4-yl)amino]methyl]-4-phenyl-1,2,4-triazole-3-thione (PubChem CID 2425905) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-2-[[methyl-(1-methylpiperidin-4-yl)amino]methyl]-4-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-2-[[methyl-(1-methylpiperidin-4-yl)amino]methyl]-4-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2425905 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-2-[[methyl-(1-methylpiperidin-4-yl)amino]methyl]-4-phenyl-1,2,4-triazole-3-thione |
| SMILES | CN1CCC(N(C)Cn2nc(-c3ccc4c(c3)OCO4)n(-c3ccccc3)c2=S)CC1 |
| InChI | InChI=1S/C23H27N5O2S/c1-25-12-10-18(11-13-25)26(2)15-27-23(31)28(19-6-4-3-5-7-19)22(24-27)17-8-9-20-21(14-17)30-16-29-20/h3-9,14,18H,10-13,15-16H2,1-2H3 |
| InChIKey | DKDAVKOMNATKSN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 47.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|