C16H13N3O2S — CID 6879870
1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-methylbenzimidazole-2-thione (PubChem CID 6879870) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is 1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-methylbenzimidazole-2-thione.
| Compound Name | 1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-methylbenzimidazole-2-thione |
|---|---|
| PubChem CID | 6879870 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-methylbenzimidazole-2-thione |
| SMILES | Cn1c(=S)n(/N=C/c2ccc3c(c2)OCO3)c2ccccc21 |
| InChI | InChI=1S/C16H13N3O2S/c1-18-12-4-2-3-5-13(12)19(16(18)22)17-9-11-6-7-14-15(8-11)21-10-20-14/h2-9H,10H2,1H3/b17-9+ |
| InChIKey | NTTJMJLPFNIAMA-RQZCQDPDSA-N |
| XLogP | 3.32 |
| TPSA | 40.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|