C16H20ClN3O3S2 — CID 25488812
5-(2-chlorophenyl)-3-[[[(3R)-1,1-dioxothiolan-3-yl]-propylamino]methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 25488812) has the molecular formula C16H20ClN3O3S2 and a molecular weight of 401.94 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-3-[[[(3R)-1,1-dioxothiolan-3-yl]-propylamino]methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(2-chlorophenyl)-3-[[[(3R)-1,1-dioxothiolan-3-yl]-propylamino]methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 25488812 |
| Molecular Formula | C16H20ClN3O3S2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 5-(2-chlorophenyl)-3-[[[(3R)-1,1-dioxothiolan-3-yl]-propylamino]methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | CCCN(Cn1nc(-c2ccccc2Cl)oc1=S)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H20ClN3O3S2/c1-2-8-19(12-7-9-25(21,22)10-12)11-20-16(24)23-15(18-20)13-5-3-4-6-14(13)17/h3-6,12H,2,7-11H2,1H3/t12-/m1/s1 |
| InChIKey | HZGUHQUSNQRQHD-GFCCVEGCSA-N |
| XLogP | 3.38 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|