C23H27ClN4O2S2 — CID 25360914
4-(4-chlorophenyl)-2-[[[(3S)-1,1-dioxothiolan-3-yl]-propylamino]methyl]-5-(4-methylphenyl)-1,2,4-triazole-3-thione (PubChem CID 25360914) has the molecular formula C23H27ClN4O2S2 and a molecular weight of 491.08 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[[[(3S)-1,1-dioxothiolan-3-yl]-propylamino]methyl]-5-(4-methylphenyl)-1,2,4-triazole-3-thione.
| Compound Name | 4-(4-chlorophenyl)-2-[[[(3S)-1,1-dioxothiolan-3-yl]-propylamino]methyl]-5-(4-methylphenyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 25360914 |
| Molecular Formula | C23H27ClN4O2S2 |
| Molecular Weight | 491.08 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[[[(3S)-1,1-dioxothiolan-3-yl]-propylamino]methyl]-5-(4-methylphenyl)-1,2,4-triazole-3-thione |
| SMILES | CCCN(Cn1nc(-c2ccc(C)cc2)n(-c2ccc(Cl)cc2)c1=S)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H27ClN4O2S2/c1-3-13-26(21-12-14-32(29,30)15-21)16-27-23(31)28(20-10-8-19(24)9-11-20)22(25-27)18-6-4-17(2)5-7-18/h4-11,21H,3,12-16H2,1-2H3/t21-/m0/s1 |
| InChIKey | NQMVKOHHZSMQBK-NRFANRHFSA-N |
| XLogP | 4.89 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.08 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|