C20H23N5O2S2 — CID 25357185
2-[[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-4-phenyl-5-pyridin-3-yl-1,2,4-triazole-3-thione (PubChem CID 25357185) has the molecular formula C20H23N5O2S2 and a molecular weight of 429.57 g/mol. Its IUPAC name is 2-[[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-4-phenyl-5-pyridin-3-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-4-phenyl-5-pyridin-3-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 25357185 |
| Molecular Formula | C20H23N5O2S2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 2-[[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-4-phenyl-5-pyridin-3-yl-1,2,4-triazole-3-thione |
| SMILES | CCN(Cn1nc(-c2cccnc2)n(-c2ccccc2)c1=S)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H23N5O2S2/c1-2-23(18-10-12-29(26,27)14-18)15-24-20(28)25(17-8-4-3-5-9-17)19(22-24)16-7-6-11-21-13-16/h3-9,11,13,18H,2,10,12,14-15H2,1H3/t18-/m1/s1 |
| InChIKey | UXWUANYQLJVEFD-GOSISDBHSA-N |
| XLogP | 2.93 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|