C17H24N4O2S2 — CID 9243099
2-[[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-4-methyl-5-(2-methylphenyl)-1,2,4-triazole-3-thione (PubChem CID 9243099) has the molecular formula C17H24N4O2S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 2-[[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-4-methyl-5-(2-methylphenyl)-1,2,4-triazole-3-thione.
| Compound Name | 2-[[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-4-methyl-5-(2-methylphenyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9243099 |
| Molecular Formula | C17H24N4O2S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 2-[[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-4-methyl-5-(2-methylphenyl)-1,2,4-triazole-3-thione |
| SMILES | CCN(Cn1nc(-c2ccccc2C)n(C)c1=S)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H24N4O2S2/c1-4-20(14-9-10-25(22,23)11-14)12-21-17(24)19(3)16(18-21)15-8-6-5-7-13(15)2/h5-8,14H,4,9-12H2,1-3H3/t14-/m0/s1 |
| InChIKey | AEVLIYXUXCPFDD-AWEZNQCLSA-N |
| XLogP | 2.39 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|