C15H20N4O2S2 — CID 25328626
2-[[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]methyl]-4-(2-methylphenyl)-1,2,4-triazole-3-thione (PubChem CID 25328626) has the molecular formula C15H20N4O2S2 and a molecular weight of 352.49 g/mol. Its IUPAC name is 2-[[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]methyl]-4-(2-methylphenyl)-1,2,4-triazole-3-thione.
| Compound Name | 2-[[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]methyl]-4-(2-methylphenyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 25328626 |
| Molecular Formula | C15H20N4O2S2 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 2-[[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]methyl]-4-(2-methylphenyl)-1,2,4-triazole-3-thione |
| SMILES | Cc1ccccc1-n1cnn(CN(C)[C@@H]2CCS(=O)(=O)C2)c1=S |
| InChI | InChI=1S/C15H20N4O2S2/c1-12-5-3-4-6-14(12)18-10-16-19(15(18)22)11-17(2)13-7-8-23(20,21)9-13/h3-6,10,13H,7-9,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | CVTZJXYPCIRNBQ-CYBMUJFWSA-N |
| XLogP | 1.79 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|