C14H17FN4O2S3 — CID 25490539
3-[[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]methyl]-5-(4-fluoroanilino)-1,3,4-thiadiazole-2-thione (PubChem CID 25490539) has the molecular formula C14H17FN4O2S3 and a molecular weight of 388.52 g/mol. Its IUPAC name is 3-[[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]methyl]-5-(4-fluoroanilino)-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-[[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]methyl]-5-(4-fluoroanilino)-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 25490539 |
| Molecular Formula | C14H17FN4O2S3 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 3-[[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]methyl]-5-(4-fluoroanilino)-1,3,4-thiadiazole-2-thione |
| SMILES | CN(Cn1nc(Nc2ccc(F)cc2)sc1=S)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H17FN4O2S3/c1-18(12-6-7-24(20,21)8-12)9-19-14(22)23-13(17-19)16-11-4-2-10(15)3-5-11/h2-5,12H,6-9H2,1H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | OKNLTVOLVQTNAJ-LBPRGKRZSA-N |
| XLogP | 2.63 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|