C21H22F2N4O2S2 — CID 25355576
2-[[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-4,5-bis(4-fluorophenyl)-1,2,4-triazole-3-thione (PubChem CID 25355576) has the molecular formula C21H22F2N4O2S2 and a molecular weight of 464.56 g/mol. Its IUPAC name is 2-[[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-4,5-bis(4-fluorophenyl)-1,2,4-triazole-3-thione.
| Compound Name | 2-[[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-4,5-bis(4-fluorophenyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 25355576 |
| Molecular Formula | C21H22F2N4O2S2 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 2-[[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-4,5-bis(4-fluorophenyl)-1,2,4-triazole-3-thione |
| SMILES | CCN(Cn1nc(-c2ccc(F)cc2)n(-c2ccc(F)cc2)c1=S)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H22F2N4O2S2/c1-2-25(19-11-12-31(28,29)13-19)14-26-21(30)27(18-9-7-17(23)8-10-18)20(24-26)15-3-5-16(22)6-4-15/h3-10,19H,2,11-14H2,1H3/t19-/m0/s1 |
| InChIKey | SJQXRHQFBVEIKB-IBGZPJMESA-N |
| XLogP | 3.81 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|