C20H30N4O2S2 — CID 9243080
5-(4-tert-butylphenyl)-2-[[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-4-methyl-1,2,4-triazole-3-thione (PubChem CID 9243080) has the molecular formula C20H30N4O2S2 and a molecular weight of 422.62 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-2-[[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-4-methyl-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-tert-butylphenyl)-2-[[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-4-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9243080 |
| Molecular Formula | C20H30N4O2S2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 5-(4-tert-butylphenyl)-2-[[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-4-methyl-1,2,4-triazole-3-thione |
| SMILES | CCN(Cn1nc(-c2ccc(C(C)(C)C)cc2)n(C)c1=S)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H30N4O2S2/c1-6-23(17-11-12-28(25,26)13-17)14-24-19(27)22(5)18(21-24)15-7-9-16(10-8-15)20(2,3)4/h7-10,17H,6,11-14H2,1-5H3/t17-/m1/s1 |
| InChIKey | FSFMPXAGNOHFKU-QGZVFWFLSA-N |
| XLogP | 3.38 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|