C20H24N4O3S2 — CID 31941989
2-[[benzyl-[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]-4-methyl-5-(2-methylfuran-3-yl)-1,2,4-triazole-3-thione (PubChem CID 31941989) has the molecular formula C20H24N4O3S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 2-[[benzyl-[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]-4-methyl-5-(2-methylfuran-3-yl)-1,2,4-triazole-3-thione.
| Compound Name | 2-[[benzyl-[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]-4-methyl-5-(2-methylfuran-3-yl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 31941989 |
| Molecular Formula | C20H24N4O3S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 2-[[benzyl-[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]-4-methyl-5-(2-methylfuran-3-yl)-1,2,4-triazole-3-thione |
| SMILES | Cc1occc1-c1nn(CN(Cc2ccccc2)[C@H]2CCS(=O)(=O)C2)c(=S)n1C |
| InChI | InChI=1S/C20H24N4O3S2/c1-15-18(8-10-27-15)19-21-24(20(28)22(19)2)14-23(12-16-6-4-3-5-7-16)17-9-11-29(25,26)13-17/h3-8,10,17H,9,11-14H2,1-2H3/t17-/m0/s1 |
| InChIKey | JXGWYQIGHNYDQQ-KRWDZBQOSA-N |
| XLogP | 3.17 |
| TPSA | 73.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|