C16H21N3O3S2 — CID 9243033
3-[[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-5-(2-methylphenyl)-1,3,4-oxadiazole-2-thione (PubChem CID 9243033) has the molecular formula C16H21N3O3S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is 3-[[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-5-(2-methylphenyl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-5-(2-methylphenyl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9243033 |
| Molecular Formula | C16H21N3O3S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 3-[[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]methyl]-5-(2-methylphenyl)-1,3,4-oxadiazole-2-thione |
| SMILES | CCN(Cn1nc(-c2ccccc2C)oc1=S)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H21N3O3S2/c1-3-18(13-8-9-24(20,21)10-13)11-19-16(23)22-15(17-19)14-7-5-4-6-12(14)2/h4-7,13H,3,8-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | ASRBXLSYHDKTGL-CYBMUJFWSA-N |
| XLogP | 2.65 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|