C21H24N4OS — CID 9281691
2-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-4-methyl-5-phenyl-1,2,4-triazole-3-thione (PubChem CID 9281691) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is 2-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-4-methyl-5-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-4-methyl-5-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9281691 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-4-methyl-5-phenyl-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(CN(Cn2nc(-c3ccccc3)n(C)c2=S)C2CC2)cc1 |
| InChI | InChI=1S/C21H24N4OS/c1-23-20(17-6-4-3-5-7-17)22-25(21(23)27)15-24(18-10-11-18)14-16-8-12-19(26-2)13-9-16/h3-9,12-13,18H,10-11,14-15H2,1-2H3 |
| InChIKey | ALHUEJQVYVYWDD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|