C20H23N5O2S — CID 9281553
1-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-4-(4-methoxyphenyl)tetrazole-5-thione (PubChem CID 9281553) has the molecular formula C20H23N5O2S and a molecular weight of 397.50 g/mol. Its IUPAC name is 1-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-4-(4-methoxyphenyl)tetrazole-5-thione.
| Compound Name | 1-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-4-(4-methoxyphenyl)tetrazole-5-thione |
|---|---|
| PubChem CID | 9281553 |
| Molecular Formula | C20H23N5O2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 1-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-4-(4-methoxyphenyl)tetrazole-5-thione |
| SMILES | COc1ccc(CN(Cn2nnn(-c3ccc(OC)cc3)c2=S)C2CC2)cc1 |
| InChI | InChI=1S/C20H23N5O2S/c1-26-18-9-3-15(4-10-18)13-23(16-5-6-16)14-24-20(28)25(22-21-24)17-7-11-19(27-2)12-8-17/h3-4,7-12,16H,5-6,13-14H2,1-2H3 |
| InChIKey | XBSOGSUTEFIVJL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|