C18H22N5O2S+ — CID 7911362
(4-methoxyphenyl)methyl-[[4-(4-methoxyphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]-methylazanium (PubChem CID 7911362) has the molecular formula C18H22N5O2S+ and a molecular weight of 372.47 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl-[[4-(4-methoxyphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]-methylazanium.
| Compound Name | (4-methoxyphenyl)methyl-[[4-(4-methoxyphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]-methylazanium |
|---|---|
| PubChem CID | 7911362 |
| Molecular Formula | C18H22N5O2S+ |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (4-methoxyphenyl)methyl-[[4-(4-methoxyphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]-methylazanium |
| SMILES | COc1ccc(C[NH+](C)Cn2nnn(-c3ccc(OC)cc3)c2=S)cc1 |
| InChI | InChI=1S/C18H21N5O2S/c1-21(12-14-4-8-16(24-2)9-5-14)13-22-18(26)23(20-19-22)15-6-10-17(25-3)11-7-15/h4-11H,12-13H2,1-3H3/p+1 |
| InChIKey | APSDCIARJDYMCW-UHFFFAOYSA-O |
| XLogP | 1.49 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|