C19H23N6O2S+ — CID 9323148
[4-(4-methoxyphenyl)-5-sulfanylidenetetrazol-1-yl]methyl-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium (PubChem CID 9323148) has the molecular formula C19H23N6O2S+ and a molecular weight of 399.50 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)-5-sulfanylidenetetrazol-1-yl]methyl-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium.
| Compound Name | [4-(4-methoxyphenyl)-5-sulfanylidenetetrazol-1-yl]methyl-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 9323148 |
| Molecular Formula | C19H23N6O2S+ |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | [4-(4-methoxyphenyl)-5-sulfanylidenetetrazol-1-yl]methyl-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium |
| SMILES | CNC(=O)c1ccc(C[NH+](C)Cn2nnn(-c3ccc(OC)cc3)c2=S)cc1 |
| InChI | InChI=1S/C19H22N6O2S/c1-20-18(26)15-6-4-14(5-7-15)12-23(2)13-24-19(28)25(22-21-24)16-8-10-17(27-3)11-9-16/h4-11H,12-13H2,1-3H3,(H,20,26)/p+1 |
| InChIKey | LDFAYCDSQXXIDT-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|