C20H26N5O2S+ — CID 9244586
(3,4-dimethoxyphenyl)methyl-[[4-(3,4-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]-methylazanium (PubChem CID 9244586) has the molecular formula C20H26N5O2S+ and a molecular weight of 400.53 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)methyl-[[4-(3,4-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]-methylazanium.
| Compound Name | (3,4-dimethoxyphenyl)methyl-[[4-(3,4-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]-methylazanium |
|---|---|
| PubChem CID | 9244586 |
| Molecular Formula | C20H26N5O2S+ |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | (3,4-dimethoxyphenyl)methyl-[[4-(3,4-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]-methylazanium |
| SMILES | COc1ccc(C[NH+](C)Cn2nnn(-c3ccc(C)c(C)c3)c2=S)cc1OC |
| InChI | InChI=1S/C20H25N5O2S/c1-14-6-8-17(10-15(14)2)25-20(28)24(21-22-25)13-23(3)12-16-7-9-18(26-4)19(11-16)27-5/h6-11H,12-13H2,1-5H3/p+1 |
| InChIKey | NBMZJIFPBAVOIG-UHFFFAOYSA-O |
| XLogP | 2.10 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|