C17H19ClN5O2+ — CID 9332981
(5-chloro-2-methoxyphenyl)methyl-methyl-[(5-oxo-4-phenyltetrazol-1-yl)methyl]azanium (PubChem CID 9332981) has the molecular formula C17H19ClN5O2+ and a molecular weight of 360.83 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)methyl-methyl-[(5-oxo-4-phenyltetrazol-1-yl)methyl]azanium.
| Compound Name | (5-chloro-2-methoxyphenyl)methyl-methyl-[(5-oxo-4-phenyltetrazol-1-yl)methyl]azanium |
|---|---|
| PubChem CID | 9332981 |
| Molecular Formula | C17H19ClN5O2+ |
| Molecular Weight | 360.83 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)methyl-methyl-[(5-oxo-4-phenyltetrazol-1-yl)methyl]azanium |
| SMILES | COc1ccc(Cl)cc1C[NH+](C)Cn1nnn(-c2ccccc2)c1=O |
| InChI | InChI=1S/C17H18ClN5O2/c1-21(11-13-10-14(18)8-9-16(13)25-2)12-22-17(24)23(20-19-22)15-6-4-3-5-7-15/h3-10H,11-12H2,1-2H3/p+1 |
| InChIKey | OSWZUDDMAZOKLR-UHFFFAOYSA-O |
| XLogP | 0.76 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.83 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |