C21H25ClN3O3+ — CID 9332428
(5-chloro-2-methoxyphenyl)methyl-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]-methylazanium (PubChem CID 9332428) has the molecular formula C21H25ClN3O3+ and a molecular weight of 402.90 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)methyl-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]-methylazanium.
| Compound Name | (5-chloro-2-methoxyphenyl)methyl-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]-methylazanium |
|---|---|
| PubChem CID | 9332428 |
| Molecular Formula | C21H25ClN3O3+ |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)methyl-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]-methylazanium |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(C[NH+](C)Cc2cc(Cl)ccc2OC)C1=O |
| InChI | InChI=1S/C21H24ClN3O3/c1-4-21(16-8-6-5-7-9-16)19(26)25(20(27)23-21)14-24(2)13-15-12-17(22)10-11-18(15)28-3/h5-12H,4,13-14H2,1-3H3,(H,23,27)/p+1/t21-/m1/s1 |
| InChIKey | RYBXHPBQUSTZEW-OAQYLSRUSA-O |
| XLogP | 2.18 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|