C23H27ClN4O2 — CID 42911323
3-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-5-ethyl-5-phenylimidazolidine-2,4-dione (PubChem CID 42911323) has the molecular formula C23H27ClN4O2 and a molecular weight of 426.95 g/mol. Its IUPAC name is 3-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-5-ethyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | 3-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-5-ethyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42911323 |
| Molecular Formula | C23H27ClN4O2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 3-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-5-ethyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CN2CCN(Cc3ccc(Cl)cc3)CC2)C1=O |
| InChI | InChI=1S/C23H27ClN4O2/c1-2-23(19-6-4-3-5-7-19)21(29)28(22(30)25-23)17-27-14-12-26(13-15-27)16-18-8-10-20(24)11-9-18/h3-11H,2,12-17H2,1H3,(H,25,30) |
| InChIKey | QMQCEZCHMWUKFD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|