C24H28N4O3 — CID 9325816
1-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]-N-phenylpiperidine-4-carboxamide (PubChem CID 9325816) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 1-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 9325816 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 1-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]-N-phenylpiperidine-4-carboxamide |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(CN2CCC(C(=O)Nc3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C24H28N4O3/c1-2-24(19-9-5-3-6-10-19)22(30)28(23(31)26-24)17-27-15-13-18(14-16-27)21(29)25-20-11-7-4-8-12-20/h3-12,18H,2,13-17H2,1H3,(H,25,29)(H,26,31)/t24-/m1/s1 |
| InChIKey | WNWFYFHUDFFLDX-XMMPIXPASA-N |
| XLogP | 3.15 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|