C25H28N4O5 — CID 31383243
N-(1,3-benzodioxol-5-yl)-1-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]piperidine-4-carboxamide (PubChem CID 31383243) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]piperidine-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 31383243 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]piperidine-4-carboxamide |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(CN2CCC(C(=O)Nc3ccc4c(c3)OCO4)CC2)C1=O |
| InChI | InChI=1S/C25H28N4O5/c1-2-25(18-6-4-3-5-7-18)23(31)29(24(32)27-25)15-28-12-10-17(11-13-28)22(30)26-19-8-9-20-21(14-19)34-16-33-20/h3-9,14,17H,2,10-13,15-16H2,1H3,(H,26,30)(H,27,32)/t25-/m1/s1 |
| InChIKey | VLGWBWXYXDXLHG-RUZDIDTESA-N |
| XLogP | 2.88 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|