C20H24N4O6 — CID 9319927
N-(1,3-benzodioxol-5-yl)-1-[(2,4,5-trioxo-3-propylimidazolidin-1-yl)methyl]piperidine-4-carboxamide (PubChem CID 9319927) has the molecular formula C20H24N4O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-[(2,4,5-trioxo-3-propylimidazolidin-1-yl)methyl]piperidine-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-[(2,4,5-trioxo-3-propylimidazolidin-1-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9319927 |
| Molecular Formula | C20H24N4O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-[(2,4,5-trioxo-3-propylimidazolidin-1-yl)methyl]piperidine-4-carboxamide |
| SMILES | CCCN1C(=O)C(=O)N(CN2CCC(C(=O)Nc3ccc4c(c3)OCO4)CC2)C1=O |
| InChI | InChI=1S/C20H24N4O6/c1-2-7-23-18(26)19(27)24(20(23)28)11-22-8-5-13(6-9-22)17(25)21-14-3-4-15-16(10-14)30-12-29-15/h3-4,10,13H,2,5-9,11-12H2,1H3,(H,21,25) |
| InChIKey | ANXKSPRNNDKEPI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|