C23H24N3O5+ — CID 8995583
N-(1,3-benzodioxol-5-yl)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidin-1-ium-4-carboxamide (PubChem CID 8995583) has the molecular formula C23H24N3O5+ and a molecular weight of 422.46 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidin-1-ium-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 8995583 |
| Molecular Formula | C23H24N3O5+ |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidin-1-ium-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)C1CC[NH+](CCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C23H23N3O5/c27-21(24-16-5-6-19-20(13-16)31-14-30-19)15-7-9-25(10-8-15)11-12-26-22(28)17-3-1-2-4-18(17)23(26)29/h1-6,13,15H,7-12,14H2,(H,24,27)/p+1 |
| InChIKey | VXBZQCOCEQHTHY-UHFFFAOYSA-O |
| XLogP | 0.94 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|