C18H23N3O4S — CID 9233252
methyl (2S)-4-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]thiomorpholine-2-carboxylate (PubChem CID 9233252) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is methyl (2S)-4-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]thiomorpholine-2-carboxylate.
| Compound Name | methyl (2S)-4-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]thiomorpholine-2-carboxylate |
|---|---|
| PubChem CID | 9233252 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | methyl (2S)-4-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]thiomorpholine-2-carboxylate |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(CN2CCS[C@H](C(=O)OC)C2)C1=O |
| InChI | InChI=1S/C18H23N3O4S/c1-3-18(13-7-5-4-6-8-13)16(23)21(17(24)19-18)12-20-9-10-26-14(11-20)15(22)25-2/h4-8,14H,3,9-12H2,1-2H3,(H,19,24)/t14-,18+/m0/s1 |
| InChIKey | XGIJSRXYOFWRPC-KBXCAEBGSA-N |
| XLogP | 1.39 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|