C21H23N3O3S — CID 8891183
(5S)-5-ethyl-3-[2-oxo-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]ethyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 8891183) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is (5S)-5-ethyl-3-[2-oxo-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]ethyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-ethyl-3-[2-oxo-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]ethyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 8891183 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (5S)-5-ethyl-3-[2-oxo-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]ethyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | CC[C@@]1(c2ccccc2)NC(=O)N(CC(=O)N2CCC[C@@H]2c2cccs2)C1=O |
| InChI | InChI=1S/C21H23N3O3S/c1-2-21(15-8-4-3-5-9-15)19(26)24(20(27)22-21)14-18(25)23-12-6-10-16(23)17-11-7-13-28-17/h3-5,7-9,11,13,16H,2,6,10,12,14H2,1H3,(H,22,27)/t16-,21+/m1/s1 |
| InChIKey | POSFDKMVYZXAGI-IERDGZPVSA-N |
| XLogP | 3.27 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|