C16H19N3O3S — CID 87022684
1-cyclopropyl-3-[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 87022684) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 1-cyclopropyl-3-[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 87022684 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 1-cyclopropyl-3-[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | O=C1CN(C2CC2)C(=O)N1CC(=O)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C16H19N3O3S/c20-14(17-7-1-3-12(17)13-4-2-8-23-13)10-19-15(21)9-18(16(19)22)11-5-6-11/h2,4,8,11-12H,1,3,5-7,9-10H2 |
| InChIKey | RMOGIEMKFLZBKF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|