C14H17N3O3S — CID 87022611
2-(3-cyclopropyl-2,5-dioxoimidazolidin-1-yl)-N-methyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 87022611) has the molecular formula C14H17N3O3S and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-(3-cyclopropyl-2,5-dioxoimidazolidin-1-yl)-N-methyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(3-cyclopropyl-2,5-dioxoimidazolidin-1-yl)-N-methyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 87022611 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-(3-cyclopropyl-2,5-dioxoimidazolidin-1-yl)-N-methyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CN(Cc1cccs1)C(=O)CN1C(=O)CN(C2CC2)C1=O |
| InChI | InChI=1S/C14H17N3O3S/c1-15(7-11-3-2-6-21-11)12(18)8-17-13(19)9-16(14(17)20)10-4-5-10/h2-3,6,10H,4-5,7-9H2,1H3 |
| InChIKey | DXWMZRVATTXAPE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|