C28H29N5O3 — CID 55511357
2-[4-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl]piperazin-1-yl]-N-phenylacetamide (PubChem CID 55511357) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is 2-[4-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl]piperazin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl]piperazin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 55511357 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 2-[4-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl]piperazin-1-yl]-N-phenylacetamide |
| SMILES | O=C(CN1CCN(CN2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C28H29N5O3/c34-25(29-24-14-8-3-9-15-24)20-31-16-18-32(19-17-31)21-33-26(35)28(30-27(33)36,22-10-4-1-5-11-22)23-12-6-2-7-13-23/h1-15H,16-21H2,(H,29,34)(H,30,36) |
| InChIKey | UFEDZLZPZJYILM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|