C25H28N4O3 — CID 36781248
N-[1-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl]piperidin-4-yl]cyclopropanecarboxamide (PubChem CID 36781248) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-[1-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl]piperidin-4-yl]cyclopropanecarboxamide.
| Compound Name | N-[1-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl]piperidin-4-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 36781248 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | N-[1-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl]piperidin-4-yl]cyclopropanecarboxamide |
| SMILES | O=C(NC1CCN(CN2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)CC1)C1CC1 |
| InChI | InChI=1S/C25H28N4O3/c30-22(18-11-12-18)26-21-13-15-28(16-14-21)17-29-23(31)25(27-24(29)32,19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-10,18,21H,11-17H2,(H,26,30)(H,27,32) |
| InChIKey | CJXOJMUQRDTZNN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|