C18H23N5OS — CID 36787144
N-[1-[(4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-4-yl]cyclopropanecarboxamide (PubChem CID 36787144) has the molecular formula C18H23N5OS and a molecular weight of 357.48 g/mol. Its IUPAC name is N-[1-[(4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-4-yl]cyclopropanecarboxamide.
| Compound Name | N-[1-[(4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-4-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 36787144 |
| Molecular Formula | C18H23N5OS |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | N-[1-[(4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-4-yl]cyclopropanecarboxamide |
| SMILES | O=C(NC1CCN(Cn2ncn(-c3ccccc3)c2=S)CC1)C1CC1 |
| InChI | InChI=1S/C18H23N5OS/c24-17(14-6-7-14)20-15-8-10-21(11-9-15)13-23-18(25)22(12-19-23)16-4-2-1-3-5-16/h1-5,12,14-15H,6-11,13H2,(H,20,24) |
| InChIKey | UDFRCIVSGNKBQP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|