C23H28N6OS — CID 29104160
N-(2,3-dimethylphenyl)-2-[4-[(4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperazin-1-yl]acetamide (PubChem CID 29104160) has the molecular formula C23H28N6OS and a molecular weight of 436.59 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[4-[(4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[4-[(4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 29104160 |
| Molecular Formula | C23H28N6OS |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[4-[(4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperazin-1-yl]acetamide |
| SMILES | Cc1cccc(NC(=O)CN2CCN(Cn3ncn(-c4ccccc4)c3=S)CC2)c1C |
| InChI | InChI=1S/C23H28N6OS/c1-18-7-6-10-21(19(18)2)25-22(30)15-26-11-13-27(14-12-26)17-29-23(31)28(16-24-29)20-8-4-3-5-9-20/h3-10,16H,11-15,17H2,1-2H3,(H,25,30) |
| InChIKey | OYBXKNHDOBDAFA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 58.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|