C20H28N6OS — CID 9279953
N-(2,3-dimethylphenyl)-2-[4-[(4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperazin-1-yl]acetamide (PubChem CID 9279953) has the molecular formula C20H28N6OS and a molecular weight of 400.55 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[4-[(4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[4-[(4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9279953 |
| Molecular Formula | C20H28N6OS |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[4-[(4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperazin-1-yl]acetamide |
| SMILES | C=CCn1cnn(CN2CCN(CC(=O)Nc3cccc(C)c3C)CC2)c1=S |
| InChI | InChI=1S/C20H28N6OS/c1-4-8-25-14-21-26(20(25)28)15-24-11-9-23(10-12-24)13-19(27)22-18-7-5-6-16(2)17(18)3/h4-7,14H,1,8-13,15H2,2-3H3,(H,22,27) |
| InChIKey | HHBKRELURHFPAD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 58.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|