C15H23N5OS — CID 36787634
N-[1-[(4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-4-yl]cyclopropanecarboxamide (PubChem CID 36787634) has the molecular formula C15H23N5OS and a molecular weight of 321.45 g/mol. Its IUPAC name is N-[1-[(4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-4-yl]cyclopropanecarboxamide.
| Compound Name | N-[1-[(4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-4-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 36787634 |
| Molecular Formula | C15H23N5OS |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | N-[1-[(4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-4-yl]cyclopropanecarboxamide |
| SMILES | C=CCn1cnn(CN2CCC(NC(=O)C3CC3)CC2)c1=S |
| InChI | InChI=1S/C15H23N5OS/c1-2-7-19-10-16-20(15(19)22)11-18-8-5-13(6-9-18)17-14(21)12-3-4-12/h2,10,12-13H,1,3-9,11H2,(H,17,21) |
| InChIKey | HLFWLURHTJMOMN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|